CAS 5408-08-2 is the registry number for Ethyl 4-iodo-3,5-dimethyl-1H-pyrrole-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 4-iodo-3,5-dimethyl-1H-pyrrole-2-carboxylate (CAS 5408-08-2) is a chemical compound with the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. IUPAC name: ethyl 4-iodo-3,5-dimethyl-1H-pyrrole-2-carboxylate. InChIKey: IYNPYGLPQFVPSC-UHFFFAOYSA-N.
| Molecular formula | C9H12INO2 |
|---|---|
| Molecular weight | 293.10 g/mol |
| IUPAC name | ethyl 4-iodo-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| InChIKey | IYNPYGLPQFVPSC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N1)C)I)C |
Computed by PubChem (NCBI)