CAS 342908-38-7 appears in our catalog under these names: 3-(3-Cyanophenoxymethyl)benzoic acid, 95%, 3-(3-Cyanophenoxymethyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-[(3-cyanophenoxy)methyl]benzoic acid (CAS 342908-38-7) is a chemical compound with the molecular formula C15H11NO3 and a molecular weight of 253.25 g/mol. IUPAC name: 3-[(3-cyanophenoxy)methyl]benzoic acid. InChIKey: ULOWGXBBARFUKC-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 3-[(3-cyanophenoxy)methyl]benzoic acid |
| InChIKey | ULOWGXBBARFUKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)COC2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)