CAS 34298-25-4 appears in our catalog under these names: (R)-(+)-beta-Methylphenethylamine hydrochloride, 98%, (R)–beta–Methylphenylethanamine Hydrochloride, (R)-(+)-β-Methylphenethylamine hydrochloride, (R)-beta-Methylphenylethanamine Hydrochloride, (R)-2-Phenylpropan-1-amine hydrochloride, 98%+,RG. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 2,5g.
(2R)-2-phenylpropan-1-amine;hydrochloride (CAS 34298-25-4) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. IUPAC name: (2R)-2-phenylpropan-1-amine;hydrochloride. InChIKey: HBVYOCJBEXSCQE-QRPNPIFTSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 171.67 g/mol |
| IUPAC name | (2R)-2-phenylpropan-1-amine;hydrochloride |
| InChIKey | HBVYOCJBEXSCQE-QRPNPIFTSA-N |
| SMILES | C[C@@H](CN)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)