CAS 343316-37-0 is the registry number for 4-Fluoro-n-(2-hydroxy-1,1-dimethylethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-fluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzamide (CAS 343316-37-0) is a chemical compound with the molecular formula C11H14FNO2 and a molecular weight of 211.23 g/mol. IUPAC name: 4-fluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzamide. InChIKey: BWHDJYZLGQXNDU-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2 |
|---|---|
| Molecular weight | 211.23 g/mol |
| IUPAC name | 4-fluoro-N-(1-hydroxy-2-methylpropan-2-yl)benzamide |
| InChIKey | BWHDJYZLGQXNDU-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)