CAS 34333-72-7 is the registry number for (R)-(-)-Mepivacaine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
(2R)-N-(2,6-dimethylphenyl)-1-methylpiperidine-2-carboxamide;hydrochloride (CAS 34333-72-7) is a chemical compound with the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. IUPAC name: (2R)-N-(2,6-dimethylphenyl)-1-methylpiperidine-2-carboxamide;hydrochloride. InChIKey: RETIMRUQNCDCQB-BTQNPOSSSA-N.
| Molecular formula | C15H23ClN2O |
|---|---|
| Molecular weight | 282.81 g/mol |
| IUPAC name | (2R)-N-(2,6-dimethylphenyl)-1-methylpiperidine-2-carboxamide;hydrochloride |
| InChIKey | RETIMRUQNCDCQB-BTQNPOSSSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)[C@H]2CCCCN2C.Cl |
Computed by PubChem (NCBI)