CAS 343631-38-9 is the registry number for H-L-MeTyr(tBu)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-2-(methylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (CAS 343631-38-9) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: (2S)-2-(methylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid. InChIKey: SPGJOSPCBLHAMK-LBPRGKRZSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | (2S)-2-(methylamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| InChIKey | SPGJOSPCBLHAMK-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)NC |
Computed by PubChem (NCBI)