Products 343774-44-7
CAS 343774-44-7 is the registry number for 2-(5-Phenyl-1,3-oxazol-2-yl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(5-phenyl-1,3-oxazol-2-yl)acetonitrile (CAS 343774-44-7) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 2-(5-phenyl-1,3-oxazol-2-yl)acetonitrile. InChIKey: HQPRFQMTHNXKMD-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-(5-phenyl-1,3-oxazol-2-yl)acetonitrile |
| InChIKey | HQPRFQMTHNXKMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)CC#N |
Computed by PubChem (NCBI)