CAS 34385-92-7 is the registry number for 2-(4-Chlorophenoxy)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
2-(4-chlorophenoxy)butanoic acid (CAS 34385-92-7) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-(4-chlorophenoxy)butanoic acid. InChIKey: CEJKAKCQVUWNNA-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 2-(4-chlorophenoxy)butanoic acid |
| InChIKey | CEJKAKCQVUWNNA-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)OC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)