CAS 343855-79-8 is the registry number for 5-Bromo-2-ethoxybenzoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-ethoxybenzoyl chloride (CAS 343855-79-8) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 5-bromo-2-ethoxybenzoyl chloride. InChIKey: JGAIMMXCWHYBGZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 5-bromo-2-ethoxybenzoyl chloride |
| InChIKey | JGAIMMXCWHYBGZ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)Br)C(=O)Cl |
Computed by PubChem (NCBI)