CAS 344298-96-0 appears in our catalog under these names: 4-Aminobiphenyl-d9, 4-Aminobiphenyl-d9, >95% (HPLC), 4-Aminobiphenyl D9 100 µg/mL in Acetone, 4-Aminobiphenyl-d9, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, Biosynth. Available pack sizes: on request, 10mg, 1mg, 2mg, 1ml, 0,1g, 0,05g, 50mg.
2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline (CAS 344298-96-0) is a chemical compound with the molecular formula C12H11N and a molecular weight of 178.28 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline. InChIKey: DMVOXQPQNTYEKQ-LOIXRAQWSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 178.28 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| InChIKey | DMVOXQPQNTYEKQ-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])N)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)