Products 112630-80-5
CAS 112630-80-5 is the registry number for 4-Aminobiphenyl-13C6. Offered by: TRC. Available pack sizes: 50mg.
4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)aniline (CAS 112630-80-5) is a chemical compound with the molecular formula C12H11N and a molecular weight of 175.18 g/mol. IUPAC name: 4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)aniline. InChIKey: DMVOXQPQNTYEKQ-GEPOPZQUSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)aniline |
| InChIKey | DMVOXQPQNTYEKQ-GEPOPZQUSA-N |
| SMILES | C1=CC(=CC=C1[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2)N |
Computed by PubChem (NCBI)