CAS 344303-87-3 is the registry number for Methyl 3-methyl-4-nitroisoxazole-5-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-methyl-4-nitro-1,2-oxazole-5-carboxylate (CAS 344303-87-3) is a chemical compound with the molecular formula C6H6N2O5 and a molecular weight of 186.12 g/mol. IUPAC name: methyl 3-methyl-4-nitro-1,2-oxazole-5-carboxylate. InChIKey: JTEPMQCAQKJDCF-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O5 |
|---|---|
| Molecular weight | 186.12 g/mol |
| IUPAC name | methyl 3-methyl-4-nitro-1,2-oxazole-5-carboxylate |
| InChIKey | JTEPMQCAQKJDCF-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)