CAS 960224-76-4 is the registry number for 2-(5-Methyl-4-nitroisoxazol-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-methyl-4-nitro-1,2-oxazol-3-yl)acetic acid (CAS 960224-76-4) is a chemical compound with the molecular formula C6H6N2O5 and a molecular weight of 186.12 g/mol. IUPAC name: 2-(5-methyl-4-nitro-1,2-oxazol-3-yl)acetic acid. InChIKey: YZUWUAKUWYKORO-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O5 |
|---|---|
| Molecular weight | 186.12 g/mol |
| IUPAC name | 2-(5-methyl-4-nitro-1,2-oxazol-3-yl)acetic acid |
| InChIKey | YZUWUAKUWYKORO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)