CAS 34489-85-5 is the registry number for 2-Amino-N-(2-bromophenyl)benzamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-N-(2-bromophenyl)benzamide (CAS 34489-85-5) is a chemical compound with the molecular formula C13H11BrN2O and a molecular weight of 291.14 g/mol. IUPAC name: 2-amino-N-(2-bromophenyl)benzamide. InChIKey: KNSXPWPBPXHJHV-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 2-amino-N-(2-bromophenyl)benzamide |
| InChIKey | KNSXPWPBPXHJHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=CC=C2Br)N |
Computed by PubChem (NCBI)