CAS 345-89-1 appears in our catalog under these names: 4-Fluoro-4'-methoxybenzophenone, (4-Fluorophenyl)(4-methoxyphenyl)methanone 98%, Methanone, (4-fluorophenyl)(4-methoxyphenyl)-, 98%, 98%, 4-Fluoro-4'-methoxybenzophenone, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5kg, 1kg, 5g, 10g, 25g, 100g, 500g, 1000g.
(4-fluorophenyl)-(4-methoxyphenyl)methanone (CAS 345-89-1) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: (4-fluorophenyl)-(4-methoxyphenyl)methanone. InChIKey: VWGWRNBIAWTWIB-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | (4-fluorophenyl)-(4-methoxyphenyl)methanone |
| InChIKey | VWGWRNBIAWTWIB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)