Products 345-91-5
CAS 345-91-5 appears in our catalog under these names: 4-Fluoro-4'-methylbenzhydrol, 95%, 4-Fluoro-4'-methylbenzhydrol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-fluorophenyl)-(4-methylphenyl)methanol (CAS 345-91-5) is a chemical compound with the molecular formula C14H13FO and a molecular weight of 216.25 g/mol. IUPAC name: (4-fluorophenyl)-(4-methylphenyl)methanol. InChIKey: RUPDLRIDZKCKHV-UHFFFAOYSA-N.
| Molecular formula | C14H13FO |
|---|---|
| Molecular weight | 216.25 g/mol |
| IUPAC name | (4-fluorophenyl)-(4-methylphenyl)methanol |
| InChIKey | RUPDLRIDZKCKHV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)