CAS 56430-67-2 is the registry number for 1-(2-Fluoro-1,1'-biphenyl-4-yl)ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(3-fluoro-4-phenylphenyl)ethanol (CAS 56430-67-2) is a chemical compound with the molecular formula C14H13FO and a molecular weight of 216.25 g/mol. IUPAC name: 1-(3-fluoro-4-phenylphenyl)ethanol. InChIKey: ARJAIPNQFNPHLW-UHFFFAOYSA-N.
| Molecular formula | C14H13FO |
|---|---|
| Molecular weight | 216.25 g/mol |
| IUPAC name | 1-(3-fluoro-4-phenylphenyl)ethanol |
| InChIKey | ARJAIPNQFNPHLW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)O |
Computed by PubChem (NCBI)