CAS 345205-43-8 appears in our catalog under these names: 3,4-Diamino-N,N-dimethylbenzamide, 95%, 3,4-Diamino-N,N-dimethylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,4-diamino-N,N-dimethylbenzamide (CAS 345205-43-8) is a chemical compound with the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. IUPAC name: 3,4-diamino-N,N-dimethylbenzamide. InChIKey: IFXIZQSFJBDAAR-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 3,4-diamino-N,N-dimethylbenzamide |
| InChIKey | IFXIZQSFJBDAAR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)