CAS 34539-21-4 is the registry number for Nintedanib Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-4-nitroaniline (CAS 34539-21-4) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N,N-dimethyl-4-nitroaniline. InChIKey: QJAIOCKFIORVFU-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N,N-dimethyl-4-nitroaniline |
| InChIKey | QJAIOCKFIORVFU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)