Products 345582-90-3
CAS 345582-90-3 appears in our catalog under these names: 6-Chloro-N-isopropylpyridazine-3-carboxamide, 95+%, 6-Chloro-N-(propan-2-yl)pyridazine-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
6-chloro-N-propan-2-ylpyridazine-3-carboxamide (CAS 345582-90-3) is a chemical compound with the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. IUPAC name: 6-chloro-N-propan-2-ylpyridazine-3-carboxamide. InChIKey: JGUWMBLELLRUNP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O |
|---|---|
| Molecular weight | 199.64 g/mol |
| IUPAC name | 6-chloro-N-propan-2-ylpyridazine-3-carboxamide |
| InChIKey | JGUWMBLELLRUNP-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=NN=C(C=C1)Cl |
Computed by PubChem (NCBI)