CAS 34576-83-5 appears in our catalog under these names: 3-Chloro-6-fluorobenzo[b]thiophene-2-carbonyl chloride, 97%, 3-Chloro-6-fluorobenzo(b)thiophene-2-carbonyl chloride, 95+%, 3-Chloro-6-fluorobenzo[b]thiophene-2-carbonyl chloride 95%, 3-Chloro-6-fluorobenzo[b]thiophene-2-carbonylchloride, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 1g.
3-chloro-6-fluoro-1-benzothiophene-2-carbonyl chloride (CAS 34576-83-5) is a chemical compound with the molecular formula C9H3Cl2FOS and a molecular weight of 249.09 g/mol. IUPAC name: 3-chloro-6-fluoro-1-benzothiophene-2-carbonyl chloride. InChIKey: IUDFNLIAWHEYEZ-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2FOS |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 3-chloro-6-fluoro-1-benzothiophene-2-carbonyl chloride |
| InChIKey | IUDFNLIAWHEYEZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)SC(=C2Cl)C(=O)Cl |
Computed by PubChem (NCBI)