Products 75998-36-6

CAS 75998-36-6 is the registry number for 3-Chloro-4-fluoro-1-benzothiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-chloro-4-fluoro-1-benzothiophene-2-carbonyl chloride (CAS 75998-36-6) is a chemical compound with the molecular formula C9H3Cl2FOS and a molecular weight of 249.09 g/mol. IUPAC name: 3-chloro-4-fluoro-1-benzothiophene-2-carbonyl chloride. InChIKey: NCSFYRPKSHPTFE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H3Cl2FOS
Molecular weight249.09 g/mol
IUPAC name3-chloro-4-fluoro-1-benzothiophene-2-carbonyl chloride
InChIKeyNCSFYRPKSHPTFE-UHFFFAOYSA-N
SMILESC1=CC(=C2C(=C1)SC(=C2Cl)C(=O)Cl)F

Computed by PubChem (NCBI)