CAS 34576-94-8 appears in our catalog under these names: BT2/ 99.77% (existing batch purity), 3,6–dichloro–benzo(b)thiophene–2–Carboxylic Acid, BT2, 3,6-Dichlorobenzo(b)thiophene-2-carboxylic acid, BT2 97%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 10mM (in 1ml dmso), 5mg.
3,6-dichloro-1-benzothiophene-2-carboxylic acid (CAS 34576-94-8) is a chemical compound with the molecular formula C9H4Cl2O2S and a molecular weight of 247.10 g/mol. IUPAC name: 3,6-dichloro-1-benzothiophene-2-carboxylic acid. InChIKey: AAHPIJMQJAZYTM-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O2S |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 3,6-dichloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | AAHPIJMQJAZYTM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)