Products 34576-95-9

CAS 34576-95-9 is the registry number for 3,4-Dichloro-1-benzothiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3,4-dichloro-1-benzothiophene-2-carboxylic acid (CAS 34576-95-9) is a chemical compound with the molecular formula C9H4Cl2O2S and a molecular weight of 247.10 g/mol. IUPAC name: 3,4-dichloro-1-benzothiophene-2-carboxylic acid. InChIKey: OIWHDKKVGXWDEW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4Cl2O2S
Molecular weight247.10 g/mol
IUPAC name3,4-dichloro-1-benzothiophene-2-carboxylic acid
InChIKeyOIWHDKKVGXWDEW-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Cl)C(=C(S2)C(=O)O)Cl

Computed by PubChem (NCBI)