CAS 34576-95-9 is the registry number for 3,4-Dichloro-1-benzothiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,4-dichloro-1-benzothiophene-2-carboxylic acid (CAS 34576-95-9) is a chemical compound with the molecular formula C9H4Cl2O2S and a molecular weight of 247.10 g/mol. IUPAC name: 3,4-dichloro-1-benzothiophene-2-carboxylic acid. InChIKey: OIWHDKKVGXWDEW-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O2S |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 3,4-dichloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | OIWHDKKVGXWDEW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)