Products 345909-05-9
CAS 345909-05-9 is the registry number for Di-n-propyl-d14-amine, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,1,2,2,3,3,3-heptadeuterio-N-(1,1,2,2,3,3,3-heptadeuteriopropyl)propan-1-amine (CAS 345909-05-9) is a chemical compound with the molecular formula C6H15N and a molecular weight of 115.28 g/mol. IUPAC name: 1,1,2,2,3,3,3-heptadeuterio-N-(1,1,2,2,3,3,3-heptadeuteriopropyl)propan-1-amine. InChIKey: WEHWNAOGRSTTBQ-ZLKPZJALSA-N.
| Molecular formula | C6H15N |
|---|---|
| Molecular weight | 115.28 g/mol |
| IUPAC name | 1,1,2,2,3,3,3-heptadeuterio-N-(1,1,2,2,3,3,3-heptadeuteriopropyl)propan-1-amine |
| InChIKey | WEHWNAOGRSTTBQ-ZLKPZJALSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)