Products 63220-61-1
CAS 63220-61-1 is the registry number for Di-n-propyl-d7-amine (mono-propyl-d7), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g.
1,1,2,2,3,3,3-heptadeuterio-N-propylpropan-1-amine (CAS 63220-61-1) is a chemical compound with the molecular formula C6H15N and a molecular weight of 108.23 g/mol. IUPAC name: 1,1,2,2,3,3,3-heptadeuterio-N-propylpropan-1-amine. InChIKey: WEHWNAOGRSTTBQ-HJHJEWFGSA-N.
| Molecular formula | C6H15N |
|---|---|
| Molecular weight | 108.23 g/mol |
| IUPAC name | 1,1,2,2,3,3,3-heptadeuterio-N-propylpropan-1-amine |
| InChIKey | WEHWNAOGRSTTBQ-HJHJEWFGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])NCCC |
Computed by PubChem (NCBI)