Products 346-61-2
CAS 346-61-2 is the registry number for 3-Fluorobenzaldehyde 2-(2,4-dinitrophenyl)hydrazone, 90%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
N-[(E)-(3-fluorophenyl)methylideneamino]-2,4-dinitroaniline (CAS 346-61-2) is a chemical compound with the molecular formula C13H9FN4O4 and a molecular weight of 304.23 g/mol. IUPAC name: N-[(E)-(3-fluorophenyl)methylideneamino]-2,4-dinitroaniline. InChIKey: ZLGVXEXMJMVYRK-OVCLIPMQSA-N.
| Molecular formula | C13H9FN4O4 |
|---|---|
| Molecular weight | 304.23 g/mol |
| IUPAC name | N-[(E)-(3-fluorophenyl)methylideneamino]-2,4-dinitroaniline |
| InChIKey | ZLGVXEXMJMVYRK-OVCLIPMQSA-N |
| SMILES | C1=CC(=CC(=C1)F)/C=N/NC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)