CAS 34604-52-9 appears in our catalog under these names: Diethylene glycol dimethanesulfonate, 95%, Diethylene Glycol Dimethanesulfonate, Ms-PEG2-Ms, Ms–PEG2–Ms, Ms-PEG2-Ms 97%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 25mg, 50mg, 100mg, 500mg, 1000mg.
2-(2-methylsulfonyloxyethoxy)ethyl methanesulfonate (CAS 34604-52-9) is a chemical compound with the molecular formula C6H14O7S2 and a molecular weight of 262.3 g/mol. IUPAC name: 2-(2-methylsulfonyloxyethoxy)ethyl methanesulfonate. InChIKey: CEGQKEWSEGCYRS-UHFFFAOYSA-N.
| Molecular formula | C6H14O7S2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 2-(2-methylsulfonyloxyethoxy)ethyl methanesulfonate |
| InChIKey | CEGQKEWSEGCYRS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOS(=O)(=O)C |
Computed by PubChem (NCBI)