CAS 83391-61-1 is the registry number for 3,3'-Oxybis(propane-1-sulfonic acid), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-sulfopropoxy)propane-1-sulfonic acid (CAS 83391-61-1) is a chemical compound with the molecular formula C6H14O7S2 and a molecular weight of 262.3 g/mol. IUPAC name: 3-(3-sulfopropoxy)propane-1-sulfonic acid. InChIKey: VMSUVWZFCQSDRU-UHFFFAOYSA-N.
| Molecular formula | C6H14O7S2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 3-(3-sulfopropoxy)propane-1-sulfonic acid |
| InChIKey | VMSUVWZFCQSDRU-UHFFFAOYSA-N |
| SMILES | C(COCCCS(=O)(=O)O)CS(=O)(=O)O |
Computed by PubChem (NCBI)