Products 83391-61-1

CAS 83391-61-1 is the registry number for 3,3'-Oxybis(propane-1-sulfonic acid), 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-sulfopropoxy)propane-1-sulfonic acid (CAS 83391-61-1) is a chemical compound with the molecular formula C6H14O7S2 and a molecular weight of 262.3 g/mol. IUPAC name: 3-(3-sulfopropoxy)propane-1-sulfonic acid. InChIKey: VMSUVWZFCQSDRU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14O7S2
Molecular weight262.3 g/mol
IUPAC name3-(3-sulfopropoxy)propane-1-sulfonic acid
InChIKeyVMSUVWZFCQSDRU-UHFFFAOYSA-N
SMILESC(COCCCS(=O)(=O)O)CS(=O)(=O)O

Computed by PubChem (NCBI)