Products 34628-95-0
CAS 34628-95-0 is the registry number for 8-Chloro-1,2,3,4,5,6-hexahydrobenzo[b]azocin-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-1,2,3,4,5,6-hexahydro-1-benzazocin-6-ol (CAS 34628-95-0) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 8-chloro-1,2,3,4,5,6-hexahydro-1-benzazocin-6-ol. InChIKey: OGSFPRYXFZYVMS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 8-chloro-1,2,3,4,5,6-hexahydro-1-benzazocin-6-ol |
| InChIKey | OGSFPRYXFZYVMS-UHFFFAOYSA-N |
| SMILES | C1CCNC2=C(C=C(C=C2)Cl)C(C1)O |
Computed by PubChem (NCBI)