CAS 3463-35-2 appears in our catalog under these names: 1,4-Di-tert-butyl-2-nitrobenzene, 97%, 2,5-Di-tert-butylnitrobenzene, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 250mg, 25g.
1,4-ditert-butyl-2-nitrobenzene (CAS 3463-35-2) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: 1,4-ditert-butyl-2-nitrobenzene. InChIKey: LXBUSXRSPLOXCP-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | 1,4-ditert-butyl-2-nitrobenzene |
| InChIKey | LXBUSXRSPLOXCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)C(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)