Products 346411-65-2
CAS 346411-65-2 is the registry number for GV2-20. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-dinitro-4-(2-phenylethylamino)benzoic acid (CAS 346411-65-2) is a chemical compound with the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. IUPAC name: 3,5-dinitro-4-(2-phenylethylamino)benzoic acid. InChIKey: XAKDDYXCEWRWEZ-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O6 |
|---|---|
| Molecular weight | 331.28 g/mol |
| IUPAC name | 3,5-dinitro-4-(2-phenylethylamino)benzoic acid |
| InChIKey | XAKDDYXCEWRWEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC2=C(C=C(C=C2[N+](=O)[O-])C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)