CAS 346413-00-1 is the registry number for 1-(4-Ethoxyphenyl)-2-(4-(methylsulfonyl)phenyl)ethanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
1-(4-ethoxyphenyl)-2-(4-methylsulfonylphenyl)ethanone (CAS 346413-00-1) is a chemical compound with the molecular formula C17H18O4S and a molecular weight of 318.4 g/mol. IUPAC name: 1-(4-ethoxyphenyl)-2-(4-methylsulfonylphenyl)ethanone. InChIKey: KCFDBQJCUNNTHR-UHFFFAOYSA-N.
| Molecular formula | C17H18O4S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 1-(4-ethoxyphenyl)-2-(4-methylsulfonylphenyl)ethanone |
| InChIKey | KCFDBQJCUNNTHR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)