CAS 69141-46-4 is the registry number for hCAIX/XII-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
(7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate (CAS 69141-46-4) is a chemical compound with the molecular formula C17H18O4S and a molecular weight of 318.4 g/mol. IUPAC name: (7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate. InChIKey: AZPHVOGLXCADAL-UHFFFAOYSA-N.
| Molecular formula | C17H18O4S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (7-oxo-3-propan-2-ylcyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate |
| InChIKey | AZPHVOGLXCADAL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC(=CC=CC2=O)C(C)C |
Computed by PubChem (NCBI)