Products 845546-24-9

CAS 845546-24-9 is the registry number for 1-(2-Fluorobenzyl)-5-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-[(2-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 845546-24-9) is a chemical compound with the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: HLGLVJXDNAWXLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12FNO3
Molecular weight237.23 g/mol
IUPAC name1-[(2-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid
InChIKeyHLGLVJXDNAWXLZ-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)CC2=CC=CC=C2F)C(=O)O

Computed by PubChem (NCBI)