CAS 346656-74-4 is the registry number for 2'-Chloro-(1,1'-biphenyl)-2-carbonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(2-chlorophenyl)benzonitrile (CAS 346656-74-4) is a chemical compound with the molecular formula C13H8ClN and a molecular weight of 213.66 g/mol. IUPAC name: 2-(2-chlorophenyl)benzonitrile. InChIKey: ZXDYQXRJKNAQJS-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-(2-chlorophenyl)benzonitrile |
| InChIKey | ZXDYQXRJKNAQJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)