CAS 5728-39-2 is the registry number for 4-(3-Chlorophenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(3-chlorophenyl)benzonitrile (CAS 5728-39-2) is a chemical compound with the molecular formula C13H8ClN and a molecular weight of 213.66 g/mol. IUPAC name: 4-(3-chlorophenyl)benzonitrile. InChIKey: MPNMDPMKZISVOK-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 4-(3-chlorophenyl)benzonitrile |
| InChIKey | MPNMDPMKZISVOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)