Products 34695-81-3
CAS 34695-81-3 is the registry number for Sclerotioramine. Offered by: GLPBio, MedChemExpress, Sigma-Aldrich. Available pack sizes: 10mg, Get quote, 1MG.
[5-chloro-3-[(1E,3E)-3,5-dimethylhepta-1,3-dienyl]-6-hydroxy-7-methyl-8-oxoisoquinolin-7-yl] acetate (CAS 34695-81-3) is a chemical compound with the molecular formula C21H24ClNO4 and a molecular weight of 389.9 g/mol. IUPAC name: [5-chloro-3-[(1E,3E)-3,5-dimethylhepta-1,3-dienyl]-6-hydroxy-7-methyl-8-oxoisoquinolin-7-yl] acetate. InChIKey: TYTKCJXGLSJWJW-NJHPPEEMSA-N.
| Molecular formula | C21H24ClNO4 |
|---|---|
| Molecular weight | 389.9 g/mol |
| IUPAC name | [5-chloro-3-[(1E,3E)-3,5-dimethylhepta-1,3-dienyl]-6-hydroxy-7-methyl-8-oxoisoquinolin-7-yl] acetate |
| InChIKey | TYTKCJXGLSJWJW-NJHPPEEMSA-N |
| SMILES | CCC(C)/C=C(\C)/C=C/C1=CC2=C(C=N1)C(=O)C(C(=C2Cl)O)(C)OC(=O)C |
Computed by PubChem (NCBI)