CAS 34702-96-0 appears in our catalog under these names: Ethyl (1S,2S)-2-phenylcyclopropane-1-carboxylate 97%, (1S,2S)-Ethyl 2-phenylcyclopropanecarboxylate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg.
Trans-ethyl (1S,2S)-2-phenylcyclopropane-1-carboxylate (CAS 34702-96-0) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-phenylcyclopropane-1-carboxylate. InChIKey: SRGUIJLJERBBCM-MNOVXSKESA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-phenylcyclopropane-1-carboxylate |
| InChIKey | SRGUIJLJERBBCM-MNOVXSKESA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C2=CC=CC=C2 |
Computed by PubChem (NCBI)