CAS 34716-60-4 is the registry number for Ethyl (1R,2R)-2-phenylcyclopropane-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
Trans-ethyl (1R,2R)-2-phenylcyclopropane-1-carboxylate (CAS 34716-60-4) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-phenylcyclopropane-1-carboxylate. InChIKey: SRGUIJLJERBBCM-WDEREUQCSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-phenylcyclopropane-1-carboxylate |
| InChIKey | SRGUIJLJERBBCM-WDEREUQCSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=CC=CC=C2 |
Computed by PubChem (NCBI)