CAS 347146-32-1 appears in our catalog under these names: N–(1–Chloroisoquinolin–6–yl)–4–methylbenzenesulfonamide, N-(1-Chloroisoquinolin-6-yl)-4-methylbenzenesulfonamide, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 10g, 5g, 1g.
N-(1-chloroisoquinolin-6-yl)-4-methylbenzenesulfonamide (CAS 347146-32-1) is a chemical compound with the molecular formula C16H13ClN2O2S and a molecular weight of 332.8 g/mol. IUPAC name: N-(1-chloroisoquinolin-6-yl)-4-methylbenzenesulfonamide. InChIKey: INLVEWAPRIFTRL-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2S |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | N-(1-chloroisoquinolin-6-yl)-4-methylbenzenesulfonamide |
| InChIKey | INLVEWAPRIFTRL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC3=C(C=C2)C(=NC=C3)Cl |
Computed by PubChem (NCBI)