CAS 53946-28-4 is the registry number for Acetyl Clotiazepam. Offered by: TRC. Available pack sizes: 25mg.
7-acetyl-5-(2-chlorophenyl)-1-methyl-3H-thieno[2,3-e][1,4]diazepin-2-one (CAS 53946-28-4) is a chemical compound with the molecular formula C16H13ClN2O2S and a molecular weight of 332.8 g/mol. IUPAC name: 7-acetyl-5-(2-chlorophenyl)-1-methyl-3H-thieno[2,3-e][1,4]diazepin-2-one. InChIKey: KQCLXVJHAPUUFL-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2S |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 7-acetyl-5-(2-chlorophenyl)-1-methyl-3H-thieno[2,3-e][1,4]diazepin-2-one |
| InChIKey | KQCLXVJHAPUUFL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(S1)N(C(=O)CN=C2C3=CC=CC=C3Cl)C |
Computed by PubChem (NCBI)