CAS 347174-28-1 appears in our catalog under these names: tert-Butyl 4-bromo-3-methylbenzoate, 98%, tert-Butyl 4-bromo-3-methylbenzoate, Benzoic acid, 4-bromo-3-methyl-, 1,1-dimethylethyl ester, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 0,5g.
Tert-butyl 4-bromo-3-methylbenzoate (CAS 347174-28-1) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: tert-butyl 4-bromo-3-methylbenzoate. InChIKey: RIHBTHGKWXRWQX-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-methylbenzoate |
| InChIKey | RIHBTHGKWXRWQX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)