CAS 347841-43-4 appears in our catalog under these names: Acetylcholine-d16 Bromide, 99 atom % D, min 98% Chemical Purity, Acetylcholine–d16 Bromide, Acetylcholine-d16 (bromide), 98.55%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 100mg, 1mg, 5mg, 1 mg, 5 mg.
[1,1,2,2-tetradeuterio-2-(2,2,2-trideuterioacetyl)oxyethyl]-tris(trideuteriomethyl)azanium bromide (CAS 347841-43-4) is a chemical compound with the molecular formula C7H16BrNO2 and a molecular weight of 242.21 g/mol. IUPAC name: [1,1,2,2-tetradeuterio-2-(2,2,2-trideuterioacetyl)oxyethyl]-tris(trideuteriomethyl)azanium bromide. InChIKey: ZEHGKSPCAMLJDC-ZHEXTGARSA-M.
| Molecular formula | C7H16BrNO2 |
|---|---|
| Molecular weight | 242.21 g/mol |
| IUPAC name | [1,1,2,2-tetradeuterio-2-(2,2,2-trideuterioacetyl)oxyethyl]-tris(trideuteriomethyl)azanium bromide |
| InChIKey | ZEHGKSPCAMLJDC-ZHEXTGARSA-M |
| SMILES | [2H]C([2H])([2H])C(=O)OC([2H])([2H])C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H].[Br-] |
Computed by PubChem (NCBI)