CAS 93449-31-1 appears in our catalog under these names: Acetylcholine–d4 bromide, Acetylcholine-1,1,2,2-d4 Bromide, 99 atom % D, min 98% Chemical Purity, Acetylcholine-d4 (bromide), 98.69%. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 1mg, 0,1g, 0,05g, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
(2-acetyloxy-1,1,2,2-tetradeuterioethyl)-trimethylazanium bromide (CAS 93449-31-1) is a chemical compound with the molecular formula C7H16BrNO2 and a molecular weight of 230.14 g/mol. IUPAC name: (2-acetyloxy-1,1,2,2-tetradeuterioethyl)-trimethylazanium bromide. InChIKey: ZEHGKSPCAMLJDC-NXMSQKFDSA-M.
| Molecular formula | C7H16BrNO2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | (2-acetyloxy-1,1,2,2-tetradeuterioethyl)-trimethylazanium bromide |
| InChIKey | ZEHGKSPCAMLJDC-NXMSQKFDSA-M |
| SMILES | [2H]C([2H])(C([2H])([2H])OC(=O)C)[N+](C)(C)C.[Br-] |
Computed by PubChem (NCBI)