Products 34825-81-5
CAS 34825-81-5 appears in our catalog under these names: N-(4-Methoxybenzyl)-n-methylmethanesulfonamide, 95%, N–(4–methoxybenzyl)–n–methylmethanesulfonamide, N-(4-methoxybenzyl)-N-methylmethanesulfonamide. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 0,5g, 50mg.
N-[(4-methoxyphenyl)methyl]-N-methylmethanesulfonamide (CAS 34825-81-5) is a chemical compound with the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]-N-methylmethanesulfonamide. InChIKey: WGQLJNNCVCEPNS-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methyl]-N-methylmethanesulfonamide |
| InChIKey | WGQLJNNCVCEPNS-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)OC)S(=O)(=O)C |
Computed by PubChem (NCBI)