CAS 786709-32-8 appears in our catalog under these names: N-Tosyl-D-Alaninol, 98%, (R)-N-(1-Hydroxypropan-2-yl)-4-methylbenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzenesulfonamide (CAS 786709-32-8) is a chemical compound with the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. IUPAC name: N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzenesulfonamide. InChIKey: GMRUIWLGWXFWAI-SECBINFHSA-N.
| Molecular formula | C10H15NO3S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzenesulfonamide |
| InChIKey | GMRUIWLGWXFWAI-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H](C)CO |
Computed by PubChem (NCBI)