CAS 34851-43-9 is the registry number for 9,9-Dimethyl-xanthene-3,6-diol. Offered by: TRC. Available pack sizes: 250mg.
9,9-dimethylxanthene-3,6-diol (CAS 34851-43-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 9,9-dimethylxanthene-3,6-diol. InChIKey: RYCIIXKBLGUHMY-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 9,9-dimethylxanthene-3,6-diol |
| InChIKey | RYCIIXKBLGUHMY-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)O)OC3=C1C=CC(=C3)O)C |
Computed by PubChem (NCBI)