Products 34909-69-8
CAS 34909-69-8 appears in our catalog under these names: phenyl di(p-tolyl) phosphate, 95%, Bis(4-methylphenyl) phenyl phosphate, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Bis(4-methylphenyl) phenyl phosphate (CAS 34909-69-8) is a chemical compound with the molecular formula C20H19O4P and a molecular weight of 354.3 g/mol. IUPAC name: bis(4-methylphenyl) phenyl phosphate. InChIKey: NVMHZSCMWYZDCC-UHFFFAOYSA-N.
| Molecular formula | C20H19O4P |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | bis(4-methylphenyl) phenyl phosphate |
| InChIKey | NVMHZSCMWYZDCC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)