Products 86864-87-1

CAS 86864-87-1 is the registry number for 2,4-Dimethylphenyl diphenyl phosphate. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

(2,4-dimethylphenyl) diphenyl phosphate (CAS 86864-87-1) is a chemical compound with the molecular formula C20H19O4P and a molecular weight of 354.3 g/mol. IUPAC name: (2,4-dimethylphenyl) diphenyl phosphate. InChIKey: AYGJSQLTGPQJPU-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19O4P
Molecular weight354.3 g/mol
IUPAC name(2,4-dimethylphenyl) diphenyl phosphate
InChIKeyAYGJSQLTGPQJPU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3)C

Computed by PubChem (NCBI)